C23H34F3N3O7Si — CID 16742622
N-[2-[4-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]but-2-ynoxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 16742622) has the molecular formula C23H34F3N3O7Si and a molecular weight of 549.62 g/mol. Its IUPAC name is N-[2-[4-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]but-2-ynoxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[4-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]but-2-ynoxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 16742622 |
| Molecular Formula | C23H34F3N3O7Si |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | N-[2-[4-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]but-2-ynoxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cc(CC#CCOCCNC(=O)C(F)(F)F)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C23H34F3N3O7Si/c1-22(2,3)37(4,5)35-14-17-16(30)12-18(36-17)29-13-15(19(31)28-21(29)33)8-6-7-10-34-11-9-27-20(32)23(24,25)26/h13,16-18,30H,8-12,14H2,1-5H3,(H,27,32)(H,28,31,33)/t16-,17+,18+/m0/s1 |
| InChIKey | XRDVUORDZHAYGA-RCCFBDPRSA-N |
| XLogP | 1.45 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|