C24H24N4O — CID 167429626
4-[4-(2-aminoethyl)phenyl]-3-(6-cyclopentylpyridazin-4-yl)oxybenzonitrile (PubChem CID 167429626) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)phenyl]-3-(6-cyclopentylpyridazin-4-yl)oxybenzonitrile.
| Compound Name | 4-[4-(2-aminoethyl)phenyl]-3-(6-cyclopentylpyridazin-4-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 167429626 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[4-(2-aminoethyl)phenyl]-3-(6-cyclopentylpyridazin-4-yl)oxybenzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(CCN)cc2)c(Oc2cnnc(C3CCCC3)c2)c1 |
| InChI | InChI=1S/C24H24N4O/c25-12-11-17-5-8-19(9-6-17)22-10-7-18(15-26)13-24(22)29-21-14-23(28-27-16-21)20-3-1-2-4-20/h5-10,13-14,16,20H,1-4,11-12,25H2 |
| InChIKey | DZZFUDOFGHQBMD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |