C26H30Cl2N4O6 — CID 167430365
(1R,3S,4S)-N-[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[2-(2,4-dichlorophenoxy)acetyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 167430365) has the molecular formula C26H30Cl2N4O6 and a molecular weight of 565.45 g/mol. Its IUPAC name is (1R,3S,4S)-N-[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[2-(2,4-dichlorophenoxy)acetyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1R,3S,4S)-N-[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[2-(2,4-dichlorophenoxy)acetyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 167430365 |
| Molecular Formula | C26H30Cl2N4O6 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | (1R,3S,4S)-N-[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[2-(2,4-dichlorophenoxy)acetyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | O=C(NC1CC1)C(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@@H]1[C@H]2CC[C@H](C2)N1C(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H30Cl2N4O6/c27-15-2-6-20(18(28)11-15)38-12-21(33)32-17-5-1-13(9-17)22(32)25(36)31-19(10-14-7-8-29-24(14)35)23(34)26(37)30-16-3-4-16/h2,6,11,13-14,16-17,19,22H,1,3-5,7-10,12H2,(H,29,35)(H,30,37)(H,31,36)/t13-,14-,17+,19-,22-/m0/s1 |
| InChIKey | KPPSQJUCBPRVFP-QWOVQTNTSA-N |
| XLogP | 1.61 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|