About (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine
(6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 16743100) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
Analyze (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine?
The IUPAC name of (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CID 16743100) is (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
What is the SMILES notation for (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine?
The canonical SMILES for (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine is Nc1nc2c(s1)C[C@H](N)CC2.
What is the InChIKey of (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine?
The InChIKey is DRRYZHHKWSHHFT-SCSAIBSYSA-N. The full InChI is InChI=1S/C7H11N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h4H,1-3,8H2,(H2,9,10)/t4-/m1/s1.
What are the key properties of (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine?
(6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine has a molecular weight of 169.25 g/mol, XLogP of 0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine is sourced from PubChem (CID 16743100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).