C20H23N5O5S — CID 167432331
(2S,5R)-N'-[(6-methoxy-3-pyridinyl)sulfonyl]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432331) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is (2S,5R)-N'-[(6-methoxy-3-pyridinyl)sulfonyl]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-N'-[(6-methoxy-3-pyridinyl)sulfonyl]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432331 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (2S,5R)-N'-[(6-methoxy-3-pyridinyl)sulfonyl]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | COc1ccc(S(=O)(=O)/N=C(\N)[C@@H]2CC[C@@H]3CN2C(=O)N3OCc2ccccc2)cn1 |
| InChI | InChI=1S/C20H23N5O5S/c1-29-18-10-8-16(11-22-18)31(27,28)23-19(21)17-9-7-15-12-24(17)20(26)25(15)30-13-14-5-3-2-4-6-14/h2-6,8,10-11,15,17H,7,9,12-13H2,1H3,(H2,21,23)/t15-,17+/m1/s1 |
| InChIKey | OSOSKXMCKQGNKO-WBVHZDCISA-N |
| XLogP | 1.54 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|