C19H20FN5O4S — CID 167432334
(2S,5R)-N'-[(5-fluoro-2-pyridinyl)sulfonyl]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432334) has the molecular formula C19H20FN5O4S and a molecular weight of 433.47 g/mol. Its IUPAC name is (2S,5R)-N'-[(5-fluoro-2-pyridinyl)sulfonyl]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-N'-[(5-fluoro-2-pyridinyl)sulfonyl]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432334 |
| Molecular Formula | C19H20FN5O4S |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (2S,5R)-N'-[(5-fluoro-2-pyridinyl)sulfonyl]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(=O)(=O)c1ccc(F)cn1)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C19H20FN5O4S/c20-14-6-9-17(22-10-14)30(27,28)23-18(21)16-8-7-15-11-24(16)19(26)25(15)29-12-13-4-2-1-3-5-13/h1-6,9-10,15-16H,7-8,11-12H2,(H2,21,23)/t15-,16+/m1/s1 |
| InChIKey | SQSTWLNAOLEONU-CVEARBPZSA-N |
| XLogP | 1.67 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|