C13H14F3N5O4S — CID 167432378
(2S,5R)-6-hydroxy-7-oxo-N'-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432378) has the molecular formula C13H14F3N5O4S and a molecular weight of 393.35 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-7-oxo-N'-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-hydroxy-7-oxo-N'-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432378 |
| Molecular Formula | C13H14F3N5O4S |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (2S,5R)-6-hydroxy-7-oxo-N'-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(=O)(=O)c1ccc(C(F)(F)F)cn1)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C13H14F3N5O4S/c14-13(15,16)7-1-4-10(18-5-7)26(24,25)19-11(17)9-3-2-8-6-20(9)12(22)21(8)23/h1,4-5,8-9,23H,2-3,6H2,(H2,17,19)/t8-,9+/m1/s1 |
| InChIKey | MPWKAZVNESYZPY-BDAKNGLRSA-N |
| XLogP | 0.80 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|