C14H14F5N5O7S2 — CID 171441198
[(2S,5R)-7-oxo-2-[(Z)-N'-[[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]sulfonyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 171441198) has the molecular formula C14H14F5N5O7S2 and a molecular weight of 523.42 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-[(Z)-N'-[[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]sulfonyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-[(Z)-N'-[[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]sulfonyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 171441198 |
| Molecular Formula | C14H14F5N5O7S2 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | [(2S,5R)-7-oxo-2-[(Z)-N'-[[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]sulfonyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\S(=O)(=O)c1ccc(C(F)(F)C(F)(F)F)nc1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H14F5N5O7S2/c15-13(16,14(17,18)19)10-4-2-8(5-21-10)32(26,27)22-11(20)9-3-1-7-6-23(9)12(25)24(7)31-33(28,29)30/h2,4-5,7,9H,1,3,6H2,(H2,20,22)(H,28,29,30)/t7-,9+/m1/s1 |
| InChIKey | FELYZEUEUUMNDH-APPZFPTMSA-N |
| XLogP | 0.78 |
| TPSA | 172.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|