C12H14FN5O4S — CID 177256976
N'-[(5-fluoro-2-pyridinyl)sulfonyl]-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 177256976) has the molecular formula C12H14FN5O4S and a molecular weight of 343.34 g/mol. Its IUPAC name is N'-[(5-fluoro-2-pyridinyl)sulfonyl]-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | N'-[(5-fluoro-2-pyridinyl)sulfonyl]-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 177256976 |
| Molecular Formula | C12H14FN5O4S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N'-[(5-fluoro-2-pyridinyl)sulfonyl]-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(=O)(=O)c1ccc(F)cn1)C1CCC2CN1C(=O)N2O |
| InChI | InChI=1S/C12H14FN5O4S/c13-7-1-4-10(15-5-7)23(21,22)16-11(14)9-3-2-8-6-17(9)12(19)18(8)20/h1,4-5,8-9,20H,2-3,6H2,(H2,14,16) |
| InChIKey | CVXMUKSMNGKXKI-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|