C18H22N6O4S — CID 167432347
(2S,5R)-N'-(1-methylimidazol-4-yl)sulfonyl-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432347) has the molecular formula C18H22N6O4S and a molecular weight of 418.48 g/mol. Its IUPAC name is (2S,5R)-N'-(1-methylimidazol-4-yl)sulfonyl-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-N'-(1-methylimidazol-4-yl)sulfonyl-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432347 |
| Molecular Formula | C18H22N6O4S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (2S,5R)-N'-(1-methylimidazol-4-yl)sulfonyl-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | Cn1cnc(S(=O)(=O)/N=C(\N)[C@@H]2CC[C@@H]3CN2C(=O)N3OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H22N6O4S/c1-22-10-16(20-12-22)29(26,27)21-17(19)15-8-7-14-9-23(15)18(25)24(14)28-11-13-5-3-2-4-6-13/h2-6,10,12,14-15H,7-9,11H2,1H3,(H2,19,21)/t14-,15+/m1/s1 |
| InChIKey | KFELGOWWIMRBTJ-CABCVRRESA-N |
| XLogP | 0.87 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|