C18H20N6O4S — CID 167432340
(2S,5R)-7-oxo-6-phenylmethoxy-N'-pyrazin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432340) has the molecular formula C18H20N6O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is (2S,5R)-7-oxo-6-phenylmethoxy-N'-pyrazin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-7-oxo-6-phenylmethoxy-N'-pyrazin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432340 |
| Molecular Formula | C18H20N6O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (2S,5R)-7-oxo-6-phenylmethoxy-N'-pyrazin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(=O)(=O)c1cnccn1)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C18H20N6O4S/c19-17(22-29(26,27)16-10-20-8-9-21-16)15-7-6-14-11-23(15)18(25)24(14)28-12-13-4-2-1-3-5-13/h1-5,8-10,14-15H,6-7,11-12H2,(H2,19,22)/t14-,15+/m1/s1 |
| InChIKey | LBVDEATULOKLKC-CABCVRRESA-N |
| XLogP | 0.92 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|