C19H21N5O4S — CID 167432356
(2S,5R)-7-oxo-6-phenylmethoxy-N'-pyridin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432356) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is (2S,5R)-7-oxo-6-phenylmethoxy-N'-pyridin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-7-oxo-6-phenylmethoxy-N'-pyridin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432356 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (2S,5R)-7-oxo-6-phenylmethoxy-N'-pyridin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(=O)(=O)c1ccccn1)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C19H21N5O4S/c20-18(22-29(26,27)17-8-4-5-11-21-17)16-10-9-15-12-23(16)19(25)24(15)28-13-14-6-2-1-3-7-14/h1-8,11,15-16H,9-10,12-13H2,(H2,20,22)/t15-,16+/m1/s1 |
| InChIKey | YYYACYWQHSQZSX-CVEARBPZSA-N |
| XLogP | 1.53 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|