C12H15N5O4S — CID 167432322
(2S,5R)-6-hydroxy-7-oxo-N'-pyridin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432322) has the molecular formula C12H15N5O4S and a molecular weight of 325.35 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-7-oxo-N'-pyridin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-hydroxy-7-oxo-N'-pyridin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432322 |
| Molecular Formula | C12H15N5O4S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (2S,5R)-6-hydroxy-7-oxo-N'-pyridin-2-ylsulfonyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(=O)(=O)c1ccccn1)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C12H15N5O4S/c13-11(15-22(20,21)10-3-1-2-6-14-10)9-5-4-8-7-16(9)12(18)17(8)19/h1-3,6,8-9,19H,4-5,7H2,(H2,13,15)/t8-,9+/m1/s1 |
| InChIKey | ZUAZOZMSLQNLBG-BDAKNGLRSA-N |
| XLogP | -0.21 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|