C14H25F3N4O4SSi — CID 167432366
(2S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-7-oxo-N'-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432366) has the molecular formula C14H25F3N4O4SSi and a molecular weight of 430.53 g/mol. Its IUPAC name is (2S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-7-oxo-N'-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-7-oxo-N'-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432366 |
| Molecular Formula | C14H25F3N4O4SSi |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | (2S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-7-oxo-N'-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | CC(C)(C)[Si](C)(C)ON1C(=O)N2C[C@H]1CC[C@H]2/C(N)=N/S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H25F3N4O4SSi/c1-13(2,3)27(4,5)25-21-9-6-7-10(20(8-9)12(21)22)11(18)19-26(23,24)14(15,16)17/h9-10H,6-8H2,1-5H3,(H2,18,19)/t9-,10+/m1/s1 |
| InChIKey | LNLXCDCIKBFCCZ-ZJUUUORDSA-N |
| XLogP | 2.40 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|