C13H17N5O5S — CID 167432376
(2S,5R)-6-hydroxy-N'-[(6-methoxy-3-pyridinyl)sulfonyl]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432376) has the molecular formula C13H17N5O5S and a molecular weight of 355.38 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-N'-[(6-methoxy-3-pyridinyl)sulfonyl]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-hydroxy-N'-[(6-methoxy-3-pyridinyl)sulfonyl]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432376 |
| Molecular Formula | C13H17N5O5S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (2S,5R)-6-hydroxy-N'-[(6-methoxy-3-pyridinyl)sulfonyl]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | COc1ccc(S(=O)(=O)/N=C(\N)[C@@H]2CC[C@@H]3CN2C(=O)N3O)cn1 |
| InChI | InChI=1S/C13H17N5O5S/c1-23-11-5-3-9(6-15-11)24(21,22)16-12(14)10-4-2-8-7-17(10)13(19)18(8)20/h3,5-6,8,10,20H,2,4,7H2,1H3,(H2,14,16)/t8-,10+/m1/s1 |
| InChIKey | IJGXBUAONCWSQB-SCZZXKLOSA-N |
| XLogP | -0.21 |
| TPSA | 138.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|