C21H25F5N3NaO8S — CID 167433893
sodium (2S)-2-[[(2S)-2-[[dideuterio-(2,3,4,5,6-pentafluorophenyl)methoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propane-1-sulfonate (PubChem CID 167433893) has the molecular formula C21H25F5N3NaO8S and a molecular weight of 599.50 g/mol. Its IUPAC name is sodium (2S)-2-[[(2S)-2-[[dideuterio-(2,3,4,5,6-pentafluorophenyl)methoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propane-1-sulfonate.
| Compound Name | sodium (2S)-2-[[(2S)-2-[[dideuterio-(2,3,4,5,6-pentafluorophenyl)methoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 167433893 |
| Molecular Formula | C21H25F5N3NaO8S |
| Molecular Weight | 599.50 g/mol |
| Exact Mass | 599.13 |
| IUPAC Name | sodium (2S)-2-[[(2S)-2-[[dideuterio-(2,3,4,5,6-pentafluorophenyl)methoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propane-1-sulfonate |
| SMILES | [2H]C([2H])(OC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC1CCNC1=O)C(O)S(=O)(=O)[O-])c1c(F)c(F)c(F)c(F)c1F.[Na+] |
| InChI | InChI=1S/C21H26F5N3O8S.Na/c1-8(2)5-11(29-21(33)37-7-10-13(22)15(24)17(26)16(25)14(10)23)19(31)28-12(20(32)38(34,35)36)6-9-3-4-27-18(9)30;/h8-9,11-12,20,32H,3-7H2,1-2H3,(H,27,30)(H,28,31)(H,29,33)(H,34,35,36);/q;+1/p-1/t9?,11-,12-,20?;/m0./s1/i7D2; |
| InChIKey | HMAOOALYSVQGEX-FPFOXKODSA-M |
| XLogP | -2.10 |
| TPSA | 173.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.50 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|