C21H23F3N2O4 — CID 167435775
2-[[2,2-difluoro-2-(oxan-4-yl)acetyl]-fluoroamino]-4-(4-ethynylpiperidin-1-yl)benzoic acid (PubChem CID 167435775) has the molecular formula C21H23F3N2O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is 2-[[2,2-difluoro-2-(oxan-4-yl)acetyl]-fluoroamino]-4-(4-ethynylpiperidin-1-yl)benzoic acid.
| Compound Name | 2-[[2,2-difluoro-2-(oxan-4-yl)acetyl]-fluoroamino]-4-(4-ethynylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 167435775 |
| Molecular Formula | C21H23F3N2O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[[2,2-difluoro-2-(oxan-4-yl)acetyl]-fluoroamino]-4-(4-ethynylpiperidin-1-yl)benzoic acid |
| SMILES | C#CC1CCN(c2ccc(C(=O)O)c(N(F)C(=O)C(F)(F)C3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C21H23F3N2O4/c1-2-14-5-9-25(10-6-14)16-3-4-17(19(27)28)18(13-16)26(24)20(29)21(22,23)15-7-11-30-12-8-15/h1,3-4,13-15H,5-12H2,(H,27,28) |
| InChIKey | FGRIFUXWQRIJDE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|