C10H14F5N3S — CID 167436758
pentafluoro-[6-[(3R)-3-methylpiperazin-1-yl]-3-pyridinyl]-λ6-sulfane (PubChem CID 167436758) has the molecular formula C10H14F5N3S and a molecular weight of 303.30 g/mol. Its IUPAC name is pentafluoro-[6-[(3R)-3-methylpiperazin-1-yl]-3-pyridinyl]-λ6-sulfane.
| Compound Name | pentafluoro-[6-[(3R)-3-methylpiperazin-1-yl]-3-pyridinyl]-λ6-sulfane |
|---|---|
| PubChem CID | 167436758 |
| Molecular Formula | C10H14F5N3S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | pentafluoro-[6-[(3R)-3-methylpiperazin-1-yl]-3-pyridinyl]-λ6-sulfane |
| SMILES | C[C@@H]1CN(c2ccc(S(F)(F)(F)(F)F)cn2)CCN1 |
| InChI | InChI=1S/C10H14F5N3S/c1-8-7-18(5-4-16-8)10-3-2-9(6-17-10)19(11,12,13,14)15/h2-3,6,8,16H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | HBCPJMIEPVBXRC-MRVPVSSYSA-N |
| XLogP | 3.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |