C24H26N2O3 — CID 167437122
4-[2-[4-[[2-(1-ethoxyethenyl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenol (PubChem CID 167437122) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[2-[4-[[2-(1-ethoxyethenyl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenol.
| Compound Name | 4-[2-[4-[[2-(1-ethoxyethenyl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 167437122 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[2-[4-[[2-(1-ethoxyethenyl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenol |
| SMILES | C=C(OCC)c1nccc(COc2ccc(C(C)(C)c3ccc(O)cc3)cc2)n1 |
| InChI | InChI=1S/C24H26N2O3/c1-5-28-17(2)23-25-15-14-20(26-23)16-29-22-12-8-19(9-13-22)24(3,4)18-6-10-21(27)11-7-18/h6-15,27H,2,5,16H2,1,3-4H3 |
| InChIKey | MTWCEKQPPATBFN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|