C36H51N3O4 — CID 167437359
4-[8-[4-[2-[4-[[2-(1-ethoxyethenyl)pyrimidin-5-yl]methoxy]phenyl]propan-2-yl]phenoxy]octoxy]butan-1-amine (PubChem CID 167437359) has the molecular formula C36H51N3O4 and a molecular weight of 589.82 g/mol. Its IUPAC name is 4-[8-[4-[2-[4-[[2-(1-ethoxyethenyl)pyrimidin-5-yl]methoxy]phenyl]propan-2-yl]phenoxy]octoxy]butan-1-amine.
| Compound Name | 4-[8-[4-[2-[4-[[2-(1-ethoxyethenyl)pyrimidin-5-yl]methoxy]phenyl]propan-2-yl]phenoxy]octoxy]butan-1-amine |
|---|---|
| PubChem CID | 167437359 |
| Molecular Formula | C36H51N3O4 |
| Molecular Weight | 589.82 g/mol |
| Exact Mass | 589.39 |
| IUPAC Name | 4-[8-[4-[2-[4-[[2-(1-ethoxyethenyl)pyrimidin-5-yl]methoxy]phenyl]propan-2-yl]phenoxy]octoxy]butan-1-amine |
| SMILES | C=C(OCC)c1ncc(COc2ccc(C(C)(C)c3ccc(OCCCCCCCCOCCCCN)cc3)cc2)cn1 |
| InChI | InChI=1S/C36H51N3O4/c1-5-41-29(2)35-38-26-30(27-39-35)28-43-34-20-16-32(17-21-34)36(3,4)31-14-18-33(19-15-31)42-25-12-9-7-6-8-11-23-40-24-13-10-22-37/h14-21,26-27H,2,5-13,22-25,28,37H2,1,3-4H3 |
| InChIKey | LAPDINHZIFWNBG-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.82 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|