C33H44ClN3O5 — CID 174238913
4-[8-[4-[2-[4-[(2-chloropyrimidin-5-yl)methoxy]phenyl]propan-2-yl]phenoxy]octoxy]butylcarbamic acid (PubChem CID 174238913) has the molecular formula C33H44ClN3O5 and a molecular weight of 598.18 g/mol. Its IUPAC name is 4-[8-[4-[2-[4-[(2-chloropyrimidin-5-yl)methoxy]phenyl]propan-2-yl]phenoxy]octoxy]butylcarbamic acid.
| Compound Name | 4-[8-[4-[2-[4-[(2-chloropyrimidin-5-yl)methoxy]phenyl]propan-2-yl]phenoxy]octoxy]butylcarbamic acid |
|---|---|
| PubChem CID | 174238913 |
| Molecular Formula | C33H44ClN3O5 |
| Molecular Weight | 598.18 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | 4-[8-[4-[2-[4-[(2-chloropyrimidin-5-yl)methoxy]phenyl]propan-2-yl]phenoxy]octoxy]butylcarbamic acid |
| SMILES | CC(C)(c1ccc(OCCCCCCCCOCCCCNC(=O)O)cc1)c1ccc(OCc2cnc(Cl)nc2)cc1 |
| InChI | InChI=1S/C33H44ClN3O5/c1-33(2,28-13-17-30(18-14-28)42-25-26-23-36-31(34)37-24-26)27-11-15-29(16-12-27)41-22-9-6-4-3-5-8-20-40-21-10-7-19-35-32(38)39/h11-18,23-24,35H,3-10,19-22,25H2,1-2H3,(H,38,39) |
| InChIKey | NMWLDFQQNWHIMY-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.18 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|