C17H15N3O — CID 167438235
2-methyl-N,N-diphenylpyrazole-3-carboxamide (PubChem CID 167438235) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-methyl-N,N-diphenylpyrazole-3-carboxamide.
| Compound Name | 2-methyl-N,N-diphenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167438235 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-methyl-N,N-diphenylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15N3O/c1-19-16(12-13-18-19)17(21)20(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-13H,1H3 |
| InChIKey | NXNHFXXSUSAJND-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |