C24H27Cl2N7O3S — CID 167438357
2-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]phenyl]methyl]guanidine;dihydrochloride (PubChem CID 167438357) has the molecular formula C24H27Cl2N7O3S and a molecular weight of 564.50 g/mol. Its IUPAC name is 2-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]phenyl]methyl]guanidine;dihydrochloride.
| Compound Name | 2-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]phenyl]methyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 167438357 |
| Molecular Formula | C24H27Cl2N7O3S |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 2-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]phenyl]methyl]guanidine;dihydrochloride |
| SMILES | CC(C)S(=O)(=O)c1ccc(-c2cnc(N)c(-c3cc(-c4ccc(CN=C(N)N)cc4)no3)n2)cc1.Cl.Cl |
| InChI | InChI=1S/C24H25N7O3S.2ClH/c1-14(2)35(32,33)18-9-7-17(8-10-18)20-13-28-23(25)22(30-20)21-11-19(31-34-21)16-5-3-15(4-6-16)12-29-24(26)27;;/h3-11,13-14H,12H2,1-2H3,(H2,25,28)(H4,26,27,29);2*1H |
| InChIKey | SRTAFADHORAZPM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 176.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|