C25H28Cl2N6O3S — CID 167438362
N'-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]phenyl]methyl]ethanimidamide;dihydrochloride (PubChem CID 167438362) has the molecular formula C25H28Cl2N6O3S and a molecular weight of 563.51 g/mol. Its IUPAC name is N'-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]phenyl]methyl]ethanimidamide;dihydrochloride.
| Compound Name | N'-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]phenyl]methyl]ethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 167438362 |
| Molecular Formula | C25H28Cl2N6O3S |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | N'-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]phenyl]methyl]ethanimidamide;dihydrochloride |
| SMILES | C/C(N)=N\Cc1ccc(-c2cc(-c3nc(-c4ccc(S(=O)(=O)C(C)C)cc4)cnc3N)on2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H26N6O3S.2ClH/c1-15(2)35(32,33)20-10-8-19(9-11-20)22-14-29-25(27)24(30-22)23-12-21(31-34-23)18-6-4-17(5-7-18)13-28-16(3)26;;/h4-12,14-15H,13H2,1-3H3,(H2,26,28)(H2,27,29);2*1H |
| InChIKey | JDMQFYWBQAVDOW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|