C18H18FN7O2 — CID 167438901
4-[6-[[5-(4-fluorophenyl)-3-methyltriazol-4-yl]methoxy]pyridazin-3-yl]piperazin-2-one (PubChem CID 167438901) has the molecular formula C18H18FN7O2 and a molecular weight of 383.39 g/mol. Its IUPAC name is 4-[6-[[5-(4-fluorophenyl)-3-methyltriazol-4-yl]methoxy]pyridazin-3-yl]piperazin-2-one.
| Compound Name | 4-[6-[[5-(4-fluorophenyl)-3-methyltriazol-4-yl]methoxy]pyridazin-3-yl]piperazin-2-one |
|---|---|
| PubChem CID | 167438901 |
| Molecular Formula | C18H18FN7O2 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[6-[[5-(4-fluorophenyl)-3-methyltriazol-4-yl]methoxy]pyridazin-3-yl]piperazin-2-one |
| SMILES | Cn1nnc(-c2ccc(F)cc2)c1COc1ccc(N2CCNC(=O)C2)nn1 |
| InChI | InChI=1S/C18H18FN7O2/c1-25-14(18(23-24-25)12-2-4-13(19)5-3-12)11-28-17-7-6-15(21-22-17)26-9-8-20-16(27)10-26/h2-7H,8-11H2,1H3,(H,20,27) |
| InChIKey | JBLVOXAWLJMEPA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |