C17H16F3NO4 — CID 167439101
1-(oxan-4-ylmethyl)-3-[2-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (PubChem CID 167439101) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is 1-(oxan-4-ylmethyl)-3-[2-(trifluoromethoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-(oxan-4-ylmethyl)-3-[2-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 167439101 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-(oxan-4-ylmethyl)-3-[2-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=C(c2ccccc2OC(F)(F)F)C(=O)N1CC1CCOCC1 |
| InChI | InChI=1S/C17H16F3NO4/c18-17(19,20)25-14-4-2-1-3-12(14)13-9-15(22)21(16(13)23)10-11-5-7-24-8-6-11/h1-4,9,11H,5-8,10H2 |
| InChIKey | IRQOHUVEJXEYPE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|