C22H26N2O2 — CID 167441327
9H-fluoren-9-ylmethyl N-(4-aminocyclohexyl)-N-methylcarbamate (PubChem CID 167441327) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(4-aminocyclohexyl)-N-methylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(4-aminocyclohexyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 167441327 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(4-aminocyclohexyl)-N-methylcarbamate |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)C1CCC(N)CC1 |
| InChI | InChI=1S/C22H26N2O2/c1-24(16-12-10-15(23)11-13-16)22(25)26-14-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-9,15-16,21H,10-14,23H2,1H3 |
| InChIKey | PNXGSZMNLBHTHL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |