C15H16N4O2S — CID 167445502
(3aR,6R,6aS)-6-amino-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-one (PubChem CID 167445502) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is (3aR,6R,6aS)-6-amino-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-one.
| Compound Name | (3aR,6R,6aS)-6-amino-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-one |
|---|---|
| PubChem CID | 167445502 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (3aR,6R,6aS)-6-amino-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-one |
| SMILES | N[C@@H]1CC[C@@H]2[C@H]1NC(=O)N2c1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C15H16N4O2S/c16-8-1-2-9-13(8)17-14(20)19(9)15-18-12-7-5-6-21-10(7)3-4-11(12)22-15/h3-4,8-9,13H,1-2,5-6,16H2,(H,17,20)/t8-,9-,13+/m1/s1 |
| InChIKey | UVTSDKZJSFAPSV-KKFJDGPESA-N |
| XLogP | 1.62 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |