About 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene
6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene (PubChem CID 167449145) has the molecular formula C15H20BrN3O
and a molecular weight of 338.25 g/mol. Its IUPAC name is 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene.
Molecular Properties
| Compound Name | 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene |
| PubChem CID | 167449145 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene |
| SMILES | C=C.CN(C)/C=C(/Br)c1cc(N2CCC2)ncc1C=O |
| InChI | InChI=1S/C13H16BrN3O.C2H4/c1-16(2)8-12(14)11-6-13(17-4-3-5-17)15-7-10(11)9-18;1-2/h6-9H,3-5H2,1-2H3;1-2H2/b12-8+; |
| InChIKey | QBAFFDYKBPLHBZ-MXZHIVQLSA-N |
| XLogP | 3.16 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene?
The IUPAC name of 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene (CID 167449145) is 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene.
What is the SMILES notation for 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene?
The canonical SMILES for 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene is C=C.CN(C)/C=C(/Br)c1cc(N2CCC2)ncc1C=O.
What is the InChIKey of 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene?
The InChIKey is QBAFFDYKBPLHBZ-MXZHIVQLSA-N. The full InChI is InChI=1S/C13H16BrN3O.C2H4/c1-16(2)8-12(14)11-6-13(17-4-3-5-17)15-7-10(11)9-18;1-2/h6-9H,3-5H2,1-2H3;1-2H2/b12-8+;.
What are the key properties of 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene?
6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene has a molecular weight of 338.25 g/mol, XLogP of 3.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(azetidin-1-yl)-4-[(E)-1-bromo-2-(dimethylamino)ethenyl]pyridine-3-carbaldehyde;ethene is sourced from PubChem (CID 167449145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).