About ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate
ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate (PubChem CID 167450563) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate |
| PubChem CID | 167450563 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate |
| SMILES | CC.CCOc1cc(O)ccc1-c1cncc(C(=O)OC)n1 |
| InChI | InChI=1S/C14H14N2O4.C2H6/c1-3-20-13-6-9(17)4-5-10(13)11-7-15-8-12(16-11)14(18)19-2;1-2/h4-8,17H,3H2,1-2H3;1-2H3 |
| InChIKey | SPGHGCPBRTZWCX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate?
The IUPAC name of ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate (CID 167450563) is ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate.
What is the SMILES notation for ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate?
The canonical SMILES for ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate is CC.CCOc1cc(O)ccc1-c1cncc(C(=O)OC)n1.
What is the InChIKey of ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate?
The InChIKey is SPGHGCPBRTZWCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O4.C2H6/c1-3-20-13-6-9(17)4-5-10(13)11-7-15-8-12(16-11)14(18)19-2;1-2/h4-8,17H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate?
ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate has a molecular weight of 304.35 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 6-(2-ethoxy-4-hydroxyphenyl)pyrazine-2-carboxylate is sourced from PubChem (CID 167450563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).