C23H28F2N2O5S — CID 167456151
4-[[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]carbamoyl]-4-(2-propan-2-ylphenyl)cyclohexane-1-sulfinic acid (PubChem CID 167456151) has the molecular formula C23H28F2N2O5S and a molecular weight of 482.55 g/mol. Its IUPAC name is 4-[[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]carbamoyl]-4-(2-propan-2-ylphenyl)cyclohexane-1-sulfinic acid.
| Compound Name | 4-[[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]carbamoyl]-4-(2-propan-2-ylphenyl)cyclohexane-1-sulfinic acid |
|---|---|
| PubChem CID | 167456151 |
| Molecular Formula | C23H28F2N2O5S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4-[[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]carbamoyl]-4-(2-propan-2-ylphenyl)cyclohexane-1-sulfinic acid |
| SMILES | COc1ccc(NC(=O)C2(c3ccccc3C(C)C)CCC(S(=O)O)CC2)c(OC(F)F)n1 |
| InChI | InChI=1S/C23H28F2N2O5S/c1-14(2)16-6-4-5-7-17(16)23(12-10-15(11-13-23)33(29)30)21(28)26-18-8-9-19(31-3)27-20(18)32-22(24)25/h4-9,14-15,22H,10-13H2,1-3H3,(H,26,28)(H,29,30) |
| InChIKey | JWSNGJMBCDJUNF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|