C24H32F2N4O5 — CID 167456464
1-cyclohexyl-3-[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]-1-(2-propan-2-ylphenyl)urea;N-hydroxyformamide (PubChem CID 167456464) has the molecular formula C24H32F2N4O5 and a molecular weight of 494.54 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]-1-(2-propan-2-ylphenyl)urea;N-hydroxyformamide.
| Compound Name | 1-cyclohexyl-3-[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]-1-(2-propan-2-ylphenyl)urea;N-hydroxyformamide |
|---|---|
| PubChem CID | 167456464 |
| Molecular Formula | C24H32F2N4O5 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1-cyclohexyl-3-[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]-1-(2-propan-2-ylphenyl)urea;N-hydroxyformamide |
| SMILES | COc1ccc(NC(=O)N(c2ccccc2C(C)C)C2CCCCC2)c(OC(F)F)n1.O=CNO |
| InChI | InChI=1S/C23H29F2N3O3.CH3NO2/c1-15(2)17-11-7-8-12-19(17)28(16-9-5-4-6-10-16)23(29)26-18-13-14-20(30-3)27-21(18)31-22(24)25;3-1-2-4/h7-8,11-16,22H,4-6,9-10H2,1-3H3,(H,26,29);1,4H,(H,2,3) |
| InChIKey | JBLBWTFKHHGEGV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|