C28H36F2N4O7 — CID 171569534
2-[2-[4-[N-[[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]carbamoyl]-2-propan-2-ylanilino]cyclohexyl]-1,3-dioxolan-2-yl]-N-hydroxyacetamide (PubChem CID 171569534) has the molecular formula C28H36F2N4O7 and a molecular weight of 578.61 g/mol. Its IUPAC name is 2-[2-[4-[N-[[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]carbamoyl]-2-propan-2-ylanilino]cyclohexyl]-1,3-dioxolan-2-yl]-N-hydroxyacetamide.
| Compound Name | 2-[2-[4-[N-[[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]carbamoyl]-2-propan-2-ylanilino]cyclohexyl]-1,3-dioxolan-2-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 171569534 |
| Molecular Formula | C28H36F2N4O7 |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 2-[2-[4-[N-[[2-(difluoromethoxy)-6-methoxy-3-pyridinyl]carbamoyl]-2-propan-2-ylanilino]cyclohexyl]-1,3-dioxolan-2-yl]-N-hydroxyacetamide |
| SMILES | COc1ccc(NC(=O)N(c2ccccc2C(C)C)C2CCC(C3(CC(=O)NO)OCCO3)CC2)c(OC(F)F)n1 |
| InChI | InChI=1S/C28H36F2N4O7/c1-17(2)20-6-4-5-7-22(20)34(27(36)31-21-12-13-24(38-3)32-25(21)41-26(29)30)19-10-8-18(9-11-19)28(16-23(35)33-37)39-14-15-40-28/h4-7,12-13,17-19,26,37H,8-11,14-16H2,1-3H3,(H,31,36)(H,33,35) |
| InChIKey | WUOVRDIUDKNMIL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 131.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|