C11H17NO2 — CID 167457089
2-(1-methoxypropan-2-yloxy)-3,6-dimethylpyridine (PubChem CID 167457089) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(1-methoxypropan-2-yloxy)-3,6-dimethylpyridine.
| Compound Name | 2-(1-methoxypropan-2-yloxy)-3,6-dimethylpyridine |
|---|---|
| PubChem CID | 167457089 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(1-methoxypropan-2-yloxy)-3,6-dimethylpyridine |
| SMILES | COCC(C)Oc1nc(C)ccc1C |
| InChI | InChI=1S/C11H17NO2/c1-8-5-6-9(2)12-11(8)14-10(3)7-13-4/h5-6,10H,7H2,1-4H3 |
| InChIKey | CHQMXVMEWORGCG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |