C11H11NO3S — CID 167457740
2-[[3-[(E)-2-sulfanylethenyl]benzoyl]amino]acetic acid (PubChem CID 167457740) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-[[3-[(E)-2-sulfanylethenyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[3-[(E)-2-sulfanylethenyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 167457740 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-[[3-[(E)-2-sulfanylethenyl]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cccc(/C=C/S)c1 |
| InChI | InChI=1S/C11H11NO3S/c13-10(14)7-12-11(15)9-3-1-2-8(6-9)4-5-16/h1-6,16H,7H2,(H,12,15)(H,13,14)/b5-4+ |
| InChIKey | VZZCHGCKEZUSBW-SNAWJCMRSA-N |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|