C25H25Cl2N5O6 — CID 167458355
2-[6-[(3,6-dichloro-5-cyano-2-pyridinyl)amino]-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-oxoquinolin-3-yl]oxyacetic acid (PubChem CID 167458355) has the molecular formula C25H25Cl2N5O6 and a molecular weight of 562.41 g/mol. Its IUPAC name is 2-[6-[(3,6-dichloro-5-cyano-2-pyridinyl)amino]-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-oxoquinolin-3-yl]oxyacetic acid.
| Compound Name | 2-[6-[(3,6-dichloro-5-cyano-2-pyridinyl)amino]-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-oxoquinolin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 167458355 |
| Molecular Formula | C25H25Cl2N5O6 |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 2-[6-[(3,6-dichloro-5-cyano-2-pyridinyl)amino]-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-oxoquinolin-3-yl]oxyacetic acid |
| SMILES | CC(C)(C)OC(=O)NCCCn1c(=O)c(OCC(=O)O)cc2cc(Nc3nc(Cl)c(C#N)cc3Cl)ccc21 |
| InChI | InChI=1S/C25H25Cl2N5O6/c1-25(2,3)38-24(36)29-7-4-8-32-18-6-5-16(30-22-17(26)10-15(12-28)21(27)31-22)9-14(18)11-19(23(32)35)37-13-20(33)34/h5-6,9-11H,4,7-8,13H2,1-3H3,(H,29,36)(H,30,31)(H,33,34) |
| InChIKey | KOBLTIIUOXCLKZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|