C20H33N3O3 — CID 167458764
tert-butyl N-[6-[(dimethylamino)methyl]-5-(3-oxocyclopentyl)-2-pyridinyl]carbamate;ethane (PubChem CID 167458764) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl N-[6-[(dimethylamino)methyl]-5-(3-oxocyclopentyl)-2-pyridinyl]carbamate;ethane.
| Compound Name | tert-butyl N-[6-[(dimethylamino)methyl]-5-(3-oxocyclopentyl)-2-pyridinyl]carbamate;ethane |
|---|---|
| PubChem CID | 167458764 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | tert-butyl N-[6-[(dimethylamino)methyl]-5-(3-oxocyclopentyl)-2-pyridinyl]carbamate;ethane |
| SMILES | CC.CN(C)Cc1nc(NC(=O)OC(C)(C)C)ccc1C1CCC(=O)C1 |
| InChI | InChI=1S/C18H27N3O3.C2H6/c1-18(2,3)24-17(23)20-16-9-8-14(12-6-7-13(22)10-12)15(19-16)11-21(4)5;1-2/h8-9,12H,6-7,10-11H2,1-5H3,(H,19,20,23);1-2H3 |
| InChIKey | ZLGBUKLHYBRQSY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |