C12H22N2O2 — CID 16745942
(6S)-6-butan-2-yl-1-butylpiperazine-2,3-dione (PubChem CID 16745942) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (6S)-6-butan-2-yl-1-butylpiperazine-2,3-dione.
| Compound Name | (6S)-6-butan-2-yl-1-butylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 16745942 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (6S)-6-butan-2-yl-1-butylpiperazine-2,3-dione |
| SMILES | CCCCN1C(=O)C(=O)NC[C@@H]1C(C)CC |
| InChI | InChI=1S/C12H22N2O2/c1-4-6-7-14-10(9(3)5-2)8-13-11(15)12(14)16/h9-10H,4-8H2,1-3H3,(H,13,15)/t9?,10-/m1/s1 |
| InChIKey | QVERZEJSWXTYFA-QVDQXJPCSA-N |
| XLogP | 1.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|