C19H34N4 — CID 167460493
4-(methylamino)-N'-[2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]azepan-4-yl]butanimidamide (PubChem CID 167460493) has the molecular formula C19H34N4 and a molecular weight of 318.51 g/mol. Its IUPAC name is 4-(methylamino)-N'-[2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]azepan-4-yl]butanimidamide.
| Compound Name | 4-(methylamino)-N'-[2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]azepan-4-yl]butanimidamide |
|---|---|
| PubChem CID | 167460493 |
| Molecular Formula | C19H34N4 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 4-(methylamino)-N'-[2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]azepan-4-yl]butanimidamide |
| SMILES | C/C=C\C=C/C(=C\C)C1CC(/N=C(/N)CCCNC)CCCN1 |
| InChI | InChI=1S/C19H34N4/c1-4-6-7-10-16(5-2)18-15-17(11-8-14-22-18)23-19(20)12-9-13-21-3/h4-7,10,17-18,21-22H,8-9,11-15H2,1-3H3,(H2,20,23)/b6-4-,10-7-,16-5+ |
| InChIKey | LUMZKBFUGNOEFJ-JREJBNLKSA-N |
| XLogP | 2.93 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|