C24H24N4OS — CID 16746077
7-methyl-N-(2-thiophen-2-ylethyl)-2,7,10-triazapentacyclo[9.8.0.02,9.04,8.013,18]nonadeca-1(19),9,11,13,15,17-hexaene-6-carboxamide (PubChem CID 16746077) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 7-methyl-N-(2-thiophen-2-ylethyl)-2,7,10-triazapentacyclo[9.8.0.02,9.04,8.013,18]nonadeca-1(19),9,11,13,15,17-hexaene-6-carboxamide.
| Compound Name | 7-methyl-N-(2-thiophen-2-ylethyl)-2,7,10-triazapentacyclo[9.8.0.02,9.04,8.013,18]nonadeca-1(19),9,11,13,15,17-hexaene-6-carboxamide |
|---|---|
| PubChem CID | 16746077 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 7-methyl-N-(2-thiophen-2-ylethyl)-2,7,10-triazapentacyclo[9.8.0.02,9.04,8.013,18]nonadeca-1(19),9,11,13,15,17-hexaene-6-carboxamide |
| SMILES | CN1C(C(=O)NCCc2cccs2)CC2Cn3c(nc4cc5ccccc5cc43)C21 |
| InChI | InChI=1S/C24H24N4OS/c1-27-21(24(29)25-9-8-18-7-4-10-30-18)13-17-14-28-20-12-16-6-3-2-5-15(16)11-19(20)26-23(28)22(17)27/h2-7,10-12,17,21-22H,8-9,13-14H2,1H3,(H,25,29) |
| InChIKey | JLFORSRSVLFNNO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |