C17H17ClN6O — CID 16746083
3-[[4-[6-(3-chloroanilino)pyrimidin-4-yl]pyrimidin-2-yl]amino]propan-1-ol (PubChem CID 16746083) has the molecular formula C17H17ClN6O and a molecular weight of 356.82 g/mol. Its IUPAC name is 3-[[4-[6-(3-chloroanilino)pyrimidin-4-yl]pyrimidin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4-[6-(3-chloroanilino)pyrimidin-4-yl]pyrimidin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 16746083 |
| Molecular Formula | C17H17ClN6O |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-[[4-[6-(3-chloroanilino)pyrimidin-4-yl]pyrimidin-2-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nccc(-c2cc(Nc3cccc(Cl)c3)ncn2)n1 |
| InChI | InChI=1S/C17H17ClN6O/c18-12-3-1-4-13(9-12)23-16-10-15(21-11-22-16)14-5-7-20-17(24-14)19-6-2-8-25/h1,3-5,7,9-11,25H,2,6,8H2,(H,19,20,24)(H,21,22,23) |
| InChIKey | GIYJWNPAJFHPEI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|