C18H18ClN5O — CID 5330404
3-[[4-[6-(3-chloroanilino)pyrazin-2-yl]-3-pyridinyl]amino]propan-1-ol (PubChem CID 5330404) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is 3-[[4-[6-(3-chloroanilino)pyrazin-2-yl]-3-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[6-(3-chloroanilino)pyrazin-2-yl]-3-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 5330404 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-[[4-[6-(3-chloroanilino)pyrazin-2-yl]-3-pyridinyl]amino]propan-1-ol |
| SMILES | OCCCNc1cnccc1-c1cncc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C18H18ClN5O/c19-13-3-1-4-14(9-13)23-18-12-21-11-17(24-18)15-5-7-20-10-16(15)22-6-2-8-25/h1,3-5,7,9-12,22,25H,2,6,8H2,(H,23,24) |
| InChIKey | NNXZUOFTJNBGTK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|