C17H20N4O — CID 16746096
11-methyl-N-prop-2-enyl-1,8,11-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-12-carboxamide (PubChem CID 16746096) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 11-methyl-N-prop-2-enyl-1,8,11-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-12-carboxamide.
| Compound Name | 11-methyl-N-prop-2-enyl-1,8,11-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 16746096 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 11-methyl-N-prop-2-enyl-1,8,11-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-12-carboxamide |
| SMILES | C=CCNC(=O)C1CC2Cn3c(nc4ccccc43)C2N1C |
| InChI | InChI=1S/C17H20N4O/c1-3-8-18-17(22)14-9-11-10-21-13-7-5-4-6-12(13)19-16(21)15(11)20(14)2/h3-7,11,14-15H,1,8-10H2,2H3,(H,18,22) |
| InChIKey | FRRADMUJMLHDED-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|