C35H33FN2O3 — CID 16746316
(2R,6Z)-2-benzyl-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-(4-methylbenzoyl)-5,8-dihydro-2H-1,4-diazocin-3-one (PubChem CID 16746316) has the molecular formula C35H33FN2O3 and a molecular weight of 548.66 g/mol. Its IUPAC name is (2R,6Z)-2-benzyl-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-(4-methylbenzoyl)-5,8-dihydro-2H-1,4-diazocin-3-one.
| Compound Name | (2R,6Z)-2-benzyl-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-(4-methylbenzoyl)-5,8-dihydro-2H-1,4-diazocin-3-one |
|---|---|
| PubChem CID | 16746316 |
| Molecular Formula | C35H33FN2O3 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | (2R,6Z)-2-benzyl-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-(4-methylbenzoyl)-5,8-dihydro-2H-1,4-diazocin-3-one |
| SMILES | COc1ccc(C2/C=C\CN(C(=O)c3ccc(C)cc3)[C@H](Cc3ccccc3)C(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C35H33FN2O3/c1-25-10-14-29(15-11-25)34(39)37-22-6-9-32(28-16-20-31(41-2)21-17-28)38(24-27-12-18-30(36)19-13-27)35(40)33(37)23-26-7-4-3-5-8-26/h3-21,32-33H,22-24H2,1-2H3/b9-6-/t32?,33-/m1/s1 |
| InChIKey | URDBSCSLUVBBDL-PRKUOWBCSA-N |
| XLogP | 6.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|