C16H27N5O4 — CID 167464143
1-[1-[2-[2-(2-formamidoethoxy)ethoxy]ethyl]piperidin-4-yl]pyrazole-4-carboxamide (PubChem CID 167464143) has the molecular formula C16H27N5O4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-[1-[2-[2-(2-formamidoethoxy)ethoxy]ethyl]piperidin-4-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[1-[2-[2-(2-formamidoethoxy)ethoxy]ethyl]piperidin-4-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167464143 |
| Molecular Formula | C16H27N5O4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[1-[2-[2-(2-formamidoethoxy)ethoxy]ethyl]piperidin-4-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(C2CCN(CCOCCOCCNC=O)CC2)c1 |
| InChI | InChI=1S/C16H27N5O4/c17-16(23)14-11-19-21(12-14)15-1-4-20(5-2-15)6-8-25-10-9-24-7-3-18-13-22/h11-13,15H,1-10H2,(H2,17,23)(H,18,22) |
| InChIKey | LYGRBFAXSBTOOR-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|