C15H23N5O2 — CID 126900915
1-[1-(cycloheptylcarbamoyl)azetidin-3-yl]pyrazole-4-carboxamide (PubChem CID 126900915) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[1-(cycloheptylcarbamoyl)azetidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[1-(cycloheptylcarbamoyl)azetidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 126900915 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-[1-(cycloheptylcarbamoyl)azetidin-3-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(C2CN(C(=O)NC3CCCCCC3)C2)c1 |
| InChI | InChI=1S/C15H23N5O2/c16-14(21)11-7-17-20(8-11)13-9-19(10-13)15(22)18-12-5-3-1-2-4-6-12/h7-8,12-13H,1-6,9-10H2,(H2,16,21)(H,18,22) |
| InChIKey | NJHGUKDKSSVDKM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |