C13H21N5O — CID 121183847
N-cycloheptyl-3-(triazol-1-yl)azetidine-1-carboxamide (PubChem CID 121183847) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is N-cycloheptyl-3-(triazol-1-yl)azetidine-1-carboxamide.
| Compound Name | N-cycloheptyl-3-(triazol-1-yl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 121183847 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-cycloheptyl-3-(triazol-1-yl)azetidine-1-carboxamide |
| SMILES | O=C(NC1CCCCCC1)N1CC(n2ccnn2)C1 |
| InChI | InChI=1S/C13H21N5O/c19-13(15-11-5-3-1-2-4-6-11)17-9-12(10-17)18-8-7-14-16-18/h7-8,11-12H,1-6,9-10H2,(H,15,19) |
| InChIKey | RTSLXHFEJWNGNJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |