C13H20N4O3 — CID 121159553
N-cyclohexyl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide (PubChem CID 121159553) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-cyclohexyl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide.
| Compound Name | N-cyclohexyl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 121159553 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-cyclohexyl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CC(N2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C13H20N4O3/c18-11-6-14-12(19)17(11)10-7-16(8-10)13(20)15-9-4-2-1-3-5-9/h9-10H,1-8H2,(H,14,19)(H,15,20) |
| InChIKey | MMSQRNQRGLYEPT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|