C20H34N6O — CID 128904827
N-[[1-(cyclohexylmethyl)pyrrolidin-2-yl]methyl]-3-(triazol-1-yl)piperidine-1-carboxamide (PubChem CID 128904827) has the molecular formula C20H34N6O and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[[1-(cyclohexylmethyl)pyrrolidin-2-yl]methyl]-3-(triazol-1-yl)piperidine-1-carboxamide.
| Compound Name | N-[[1-(cyclohexylmethyl)pyrrolidin-2-yl]methyl]-3-(triazol-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 128904827 |
| Molecular Formula | C20H34N6O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | N-[[1-(cyclohexylmethyl)pyrrolidin-2-yl]methyl]-3-(triazol-1-yl)piperidine-1-carboxamide |
| SMILES | O=C(NCC1CCCN1CC1CCCCC1)N1CCCC(n2ccnn2)C1 |
| InChI | InChI=1S/C20H34N6O/c27-20(25-12-5-9-19(16-25)26-13-10-22-23-26)21-14-18-8-4-11-24(18)15-17-6-2-1-3-7-17/h10,13,17-19H,1-9,11-12,14-16H2,(H,21,27) |
| InChIKey | VSZRLQHAKMNVPI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |