C16H22N2O — CID 54152625
N-[[1-(cyclopropylmethyl)pyrrolidin-2-yl]methyl]benzamide (PubChem CID 54152625) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-[[1-(cyclopropylmethyl)pyrrolidin-2-yl]methyl]benzamide.
| Compound Name | N-[[1-(cyclopropylmethyl)pyrrolidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 54152625 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[[1-(cyclopropylmethyl)pyrrolidin-2-yl]methyl]benzamide |
| SMILES | O=C(NCC1CCCN1CC1CC1)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O/c19-16(14-5-2-1-3-6-14)17-11-15-7-4-10-18(15)12-13-8-9-13/h1-3,5-6,13,15H,4,7-12H2,(H,17,19) |
| InChIKey | OIUFWMBUDATBOE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |